![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| BCwBleed.pdf | 2015-05-11 21:04 | 209K | |
| Growing Your Secular..> | 2015-05-11 21:04 | 169K | |
| Letters to the Edito..> | 2015-05-11 21:04 | 121K | |
| How to Structure You..> | 2015-05-11 21:04 | 257K | |
| Message Clarificatio..> | 2015-05-11 21:04 | 224K | |
| ShineTagLrg.pdf | 2015-05-11 21:04 | 211K | |
| Online Social Media.pdf | 2015-05-11 21:04 | 247K | |
| Press Releases.pdf | 2015-05-11 21:04 | 193K | |
| ShineTagSm.pdf | 2015-05-11 21:04 | 208K | |
| TV and Radio Reminde..> | 2015-05-11 21:04 | 77K | |
| Talking Point Planne..> | 2015-05-11 21:04 | 292K | |